6-METHYL-2-[(4-METHYLPYRIMIDIN-2-YL)SULFANYL]PYRIDINE-3-CARBOXIMIDAMIDE

pro_cas
pro_cdbregno
CCD03328665
pro_formula
C12 H13 N5 S
pro_molWeight
259.336

basic_info

Product_Name: 6-METHYL-2-[(4-METHYLPYRIMIDIN-2-YL)SULFANYL]PYRIDINE-3-CARBOXIMIDAMIDE
EnglishSynonyms: 6-METHYL-2-[(4-METHYLPYRIMIDIN-2-YL)SULFANYL]PYRIDINE-3-CARBOXIMIDAMIDE
pro_mdlNumber: MFCD17049926
pro_acceptors: 5
pro_donors: 2
pro_smile: Cc1ccc(c(n1)Sc2nccc(n2)C)C(=N)N
InChi: InChI=1S/C12H13N5S/c1-7-3-4-9(10(13)14)11(16-7)18-12-15-6-5-8(2)17-12/h3-6H,1-2H3,(H3,13,14)
InChiKey: InChIKey=JGZYVPIRGZPJRY-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.