3-([(4-METHYLPYRIMIDIN-2-YL)SULFANYL]METHYL)BENZENE-1-CARBOXIMIDAMIDE

pro_cas
pro_cdbregno
CCD03328666
pro_formula
C13 H14 N4 S
pro_molWeight
258.348

basic_info

Product_Name: 3-([(4-METHYLPYRIMIDIN-2-YL)SULFANYL]METHYL)BENZENE-1-CARBOXIMIDAMIDE
EnglishSynonyms: 3-([(4-METHYLPYRIMIDIN-2-YL)SULFANYL]METHYL)BENZENE-1-CARBOXIMIDAMIDE
pro_mdlNumber: MFCD17049927
pro_acceptors: 4
pro_donors: 2
pro_smile: Cc1ccnc(n1)SCc2cccc(c2)C(=N)N
InChi: InChI=1S/C13H14N4S/c1-9-5-6-16-13(17-9)18-8-10-3-2-4-11(7-10)12(14)15/h2-7H,8H2,1H3,(H3,14,15)
InChiKey: InChIKey=NYBYTDSSDNZYAP-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.