2-[(1-CYCLOHEXYL-3-ETHYL-1H-PYRAZOL-5-YL)SULFANYL]ACETIC ACID

pro_cas
pro_cdbregno
CCD03343709
pro_formula
C13 H20 N2 O2 S
pro_molWeight
268.379

basic_info

Product_Name: 2-[(1-CYCLOHEXYL-3-ETHYL-1H-PYRAZOL-5-YL)SULFANYL]ACETIC ACID
EnglishSynonyms: 2-[(1-CYCLOHEXYL-3-ETHYL-1H-PYRAZOL-5-YL)SULFANYL]ACETIC ACID
pro_mdlNumber: MFCD17065522
pro_acceptors: 4
pro_donors: 1
pro_smile: CCc1cc(n(n1)C2CCCCC2)SCC(=O)O
InChi: InChI=1S/C13H20N2O2S/c1-2-10-8-12(18-9-13(16)17)15(14-10)11-6-4-3-5-7-11/h8,11H,2-7,9H2,1H3,(H,16,17)
InChiKey: InChIKey=RUMWTYSDFKDQJN-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.