C15 H27 N O2


pro_mdlNumber: MFCD17081116
pro_acceptors: 3
pro_donors: 1
pro_smile: CCCCCOCc1cc(co1)CNC(C)(C)C
InChi: InChI=1S/C15H27NO2/c1-5-6-7-8-17-12-14-9-13(11-18-14)10-16-15(2,3)4/h9,11,16H,5-8,10,12H2,1-4H3