SELENA SEL10724412

pro_cas
pro_cdbregno
CCD03385719
pro_formula
C11 H14 N6 O
pro_molWeight
246.273

basic_info

Product_Name: SELENA SEL10724412
EnglishSynonyms: SELENA SEL10724412
pro_mdlNumber: MFCD17119141
pro_acceptors: 7
pro_donors: 2
pro_smile: CNC(=O)Cn1cc(cn1)NCc2cnccn2
InChi: InChI=1S/C11H14N6O/c1-12-11(18)8-17-7-10(6-16-17)15-5-9-4-13-2-3-14-9/h2-4,6-7,15H,5,8H2,1H3,(H,12,18)
InChiKey: InChIKey=KPGWNNIGESNNSF-UHFFFAOYSA-N