SELENA SEL10736676

pro_cas
pro_cdbregno
CCD03396695
pro_formula
C11 H18 N4 O4
pro_molWeight
270.287

basic_info

Product_Name: SELENA SEL10736676
EnglishSynonyms: SELENA SEL10736676
pro_mdlNumber: MFCD17130750
pro_acceptors: 8
pro_donors: 1
pro_smile: CCN(CC(C)C(=O)O)c1c(=O)n(c(=O)n(n1)C)C
InChi: InChI=1S/C11H18N4O4/c1-5-15(6-7(2)10(17)18)8-9(16)13(3)11(19)14(4)12-8/h7H,5-6H2,1-4H3,(H,17,18)
InChiKey: InChIKey=LCNJSYCEZZQWJW-UHFFFAOYSA-N