3-[ETHYL(3-FLUORO-2-NITROPHENYL)AMINO]-2-METHYLPROPANOIC ACID

pro_cas
pro_cdbregno
CCD03396696
pro_formula
C12 H15 F N2 O4
pro_molWeight
270.259

basic_info

Product_Name: 3-[ETHYL(3-FLUORO-2-NITROPHENYL)AMINO]-2-METHYLPROPANOIC ACID
EnglishSynonyms: 3-[ETHYL(3-FLUORO-2-NITROPHENYL)AMINO]-2-METHYLPROPANOIC ACID
pro_mdlNumber: MFCD17130751
pro_acceptors: 6
pro_donors: 1
pro_smile: CCN(CC(C)C(=O)O)c1cccc(c1[N+](=O)[O-])F
InChi: InChI=1S/C12H15FN2O4/c1-3-14(7-8(2)12(16)17)10-6-4-5-9(13)11(10)15(18)19/h4-6,8H,3,7H2,1-2H3,(H,16,17)
InChiKey: InChIKey=WAGRYOLONRMPIO-UHFFFAOYSA-N