4-METHYL-1-(2-METHYLFURAN-3-YL)PENTANE-1,3-DIONE

pro_cas
pro_cdbregno
CCD03496333
pro_formula
C11 H14 O3
pro_molWeight
194.229

basic_info

Product_Name: 4-METHYL-1-(2-METHYLFURAN-3-YL)PENTANE-1,3-DIONE
EnglishSynonyms: 4-METHYL-1-(2-METHYLFURAN-3-YL)PENTANE-1,3-DIONE
pro_mdlNumber: MFCD17234336
pro_acceptors: 3
pro_donors: 0
pro_smile: Cc1c(cco1)C(=O)CC(=O)C(C)C
InChi: InChI=1S/C11H14O3/c1-7(2)10(12)6-11(13)9-4-5-14-8(9)3/h4-5,7H,6H2,1-3H3
InChiKey: InChIKey=ZQRVBJFZCTUQMJ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.