N-[(1-ETHYL-1H-IMIDAZOL-2-YL)METHYL]-2-(PROPAN-2-YLOXY)PYRIDIN-3-AMINE

pro_cas
pro_cdbregno
CCD03591855
pro_formula
C14 H20 N4 O
pro_molWeight
260.339

basic_info

Product_Name: N-[(1-ETHYL-1H-IMIDAZOL-2-YL)METHYL]-2-(PROPAN-2-YLOXY)PYRIDIN-3-AMINE
EnglishSynonyms: N-[(1-ETHYL-1H-IMIDAZOL-2-YL)METHYL]-2-(PROPAN-2-YLOXY)PYRIDIN-3-AMINE
pro_mdlNumber: MFCD17333552
pro_acceptors: 5
pro_donors: 1
pro_smile: CCn1ccnc1CNc2cccnc2OC(C)C
InChi: InChI=1S/C14H20N4O/c1-4-18-9-8-15-13(18)10-17-12-6-5-7-16-14(12)19-11(2)3/h5-9,11,17H,4,10H2,1-3H3
InChiKey: InChIKey=NGUBEMPKHMGEDX-UHFFFAOYSA-N