5-BROMO-3-(CYCLOBUTYLSULFAMOYL)-2-FLUOROBENZOIC ACID

pro_cas
pro_cdbregno
CCD03596378
pro_formula
C11 H11 Br F N O4 S
pro_molWeight
352.179

basic_info

Product_Name: 5-BROMO-3-(CYCLOBUTYLSULFAMOYL)-2-FLUOROBENZOIC ACID
EnglishSynonyms: 5-BROMO-3-(CYCLOBUTYLSULFAMOYL)-2-FLUOROBENZOIC ACID
pro_mdlNumber: MFCD17338218
pro_acceptors: 5
pro_donors: 2
pro_smile: c1c(cc(c(c1C(=O)O)F)S(=O)(=O)NC2CCC2)Br
InChi: InChI=1S/C11H11BrFNO4S/c12-6-4-8(11(15)16)10(13)9(5-6)19(17,18)14-7-2-1-3-7/h4-5,7,14H,1-3H2,(H,15,16)
InChiKey: InChIKey=RVQLYXNWOKLVHZ-UHFFFAOYSA-N