FCHGROUP FCH589723

pro_cas
pro_cdbregno
CCD03607646
pro_formula
C12 H10 Cl N3 S
pro_molWeight
263.751

basic_info

Product_Name: FCHGROUP FCH589723
EnglishSynonyms: FCHGROUP FCH589723
pro_mdlNumber: MFCD17349897
pro_acceptors: 3
pro_donors: 1
pro_smile: Cc1c(sc(n1)Nc2ccc(cc2C#N)Cl)C
InChi: InChI=1S/C12H10ClN3S/c1-7-8(2)17-12(15-7)16-11-4-3-10(13)5-9(11)6-14/h3-5H,1-2H3,(H,15,16)
InChiKey: InChIKey=IYMBRQIZLUQRMJ-UHFFFAOYSA-N