2-AMINO-N-ETHYL-N-(1-METHOXYPROPAN-2-YL)-2-PHENYLPROPANAMIDE

pro_cas
pro_cdbregno
CCD03607897
pro_formula
C15 H24 N2 O2
pro_molWeight
264.367

basic_info

Product_Name: 2-AMINO-N-ETHYL-N-(1-METHOXYPROPAN-2-YL)-2-PHENYLPROPANAMIDE
EnglishSynonyms: 2-AMINO-N-ETHYL-N-(1-METHOXYPROPAN-2-YL)-2-PHENYLPROPANAMIDE
pro_mdlNumber: MFCD17350150
pro_acceptors: 4
pro_donors: 1
pro_smile: CCN(C(C)COC)C(=O)C(C)(c1ccccc1)N
InChi: InChI=1S/C15H24N2O2/c1-5-17(12(2)11-19-4)14(18)15(3,16)13-9-7-6-8-10-13/h6-10,12H,5,11,16H2,1-4H3
InChiKey: InChIKey=LDKKXKMKQPWFMF-UHFFFAOYSA-N