3-(2,6-DIOXOPIPERIDIN-1-YL)-2-PHENYLPROPANOIC ACID

pro_cas
pro_cdbregno
CCD03657379
pro_formula
C14 H15 N O4
pro_molWeight
261.276

basic_info

Product_Name: 3-(2,6-DIOXOPIPERIDIN-1-YL)-2-PHENYLPROPANOIC ACID
EnglishSynonyms: 3-(2,6-DIOXOPIPERIDIN-1-YL)-2-PHENYLPROPANOIC ACID
pro_mdlNumber: MFCD17401998
pro_acceptors: 5
pro_donors: 1
pro_smile: c1ccc(cc1)C(CN2C(=O)CCCC2=O)C(=O)O
InChi: InChI=1S/C14H15NO4/c16-12-7-4-8-13(17)15(12)9-11(14(18)19)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,18,19)
InChiKey: InChIKey=IYAYRFCFDXMMEG-UHFFFAOYSA-N