FCHGROUP FCH647523

pro_cas
pro_cdbregno
CCD03657384
pro_formula
C14 H20 N4
pro_molWeight
244.34

basic_info

Product_Name: FCHGROUP FCH647523
EnglishSynonyms: FCHGROUP FCH647523
pro_mdlNumber: MFCD17402003
pro_acceptors: 4
pro_donors: 1
pro_smile: CCCc1nc(n(n1)C)C(CN)c2ccccc2
InChi: InChI=1S/C14H20N4/c1-3-7-13-16-14(18(2)17-13)12(10-15)11-8-5-4-6-9-11/h4-6,8-9,12H,3,7,10,15H2,1-2H3
InChiKey: InChIKey=OOSPKOFHAMZTSE-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.