N-(3-METHOXYPROPYL)-N-METHYL-6-(METHYLAMINO)PYRIDINE-3-CARBOXAMIDE

pro_cas
pro_cdbregno
CCD03670867
pro_formula
C12 H19 N3 O2
pro_molWeight
237.301

basic_info

Product_Name: N-(3-METHOXYPROPYL)-N-METHYL-6-(METHYLAMINO)PYRIDINE-3-CARBOXAMIDE
EnglishSynonyms: N-(3-METHOXYPROPYL)-N-METHYL-6-(METHYLAMINO)PYRIDINE-3-CARBOXAMIDE
pro_mdlNumber: MFCD17415930
pro_acceptors: 5
pro_donors: 1
pro_smile: CNc1ccc(cn1)C(=O)N(C)CCCOC
InChi: InChI=1S/C12H19N3O2/c1-13-11-6-5-10(9-14-11)12(16)15(2)7-4-8-17-3/h5-6,9H,4,7-8H2,1-3H3,(H,13,14)
InChiKey: InChIKey=PLUCFXDLQFJLAU-UHFFFAOYSA-N