2-CHLORO-N-[3-(PROPAN-2-YL)PHENYL]PYRIMIDIN-4-AMINE

pro_cas
pro_cdbregno
CCD03685100
pro_formula
C13 H14 Cl N3
pro_molWeight
247.728

basic_info

Product_Name: 2-CHLORO-N-[3-(PROPAN-2-YL)PHENYL]PYRIMIDIN-4-AMINE
EnglishSynonyms: 2-CHLORO-N-[3-(PROPAN-2-YL)PHENYL]PYRIMIDIN-4-AMINE
pro_mdlNumber: MFCD17431208
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(C)c1cccc(c1)Nc2ccnc(n2)Cl
InChi: InChI=1S/C13H14ClN3/c1-9(2)10-4-3-5-11(8-10)16-12-6-7-15-13(14)17-12/h3-9H,1-2H3,(H,15,16,17)
InChiKey: InChIKey=MVGSQBYPRUQHJR-UHFFFAOYSA-N