1-(5-FLUORO-2-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)SULFANYL]PHENYL)ETHAN-1-ONE

pro_cas
pro_cdbregno
CCD03685103
pro_formula
C11 H9 F N2 O2 S
pro_molWeight
252.268

basic_info

Product_Name: 1-(5-FLUORO-2-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)SULFANYL]PHENYL)ETHAN-1-ONE
EnglishSynonyms: 1-(5-FLUORO-2-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)SULFANYL]PHENYL)ETHAN-1-ONE
pro_mdlNumber: MFCD17431211
pro_acceptors: 4
pro_donors: 0
pro_smile: Cc1nnc(o1)Sc2ccc(cc2C(=O)C)F
InChi: InChI=1S/C11H9FN2O2S/c1-6(15)9-5-8(12)3-4-10(9)17-11-14-13-7(2)16-11/h3-5H,1-2H3
InChiKey: InChIKey=DCFBWHVIFYALNI-UHFFFAOYSA-N