C13 H15 N3 S


pro_mdlNumber: MFCD17440213
pro_acceptors: 3
pro_donors: 1
pro_smile: Cc1ccc(cc1NC2=NC(CS2)(C)C)C#N
InChi: InChI=1S/C13H15N3S/c1-9-4-5-10(7-14)6-11(9)15-12-16-13(2,3)8-17-12/h4-6H,8H2,1-3H3,(H,15,16)