5-CHLORO-2-([ETHYL(FURAN-2-YLMETHYL)AMINO]METHYL)ANILINE

pro_cas
pro_cdbregno
CCD03694113
pro_formula
C14 H17 Cl N2 O
pro_molWeight
264.754

basic_info

Product_Name: 5-CHLORO-2-([ETHYL(FURAN-2-YLMETHYL)AMINO]METHYL)ANILINE
EnglishSynonyms: 5-CHLORO-2-([ETHYL(FURAN-2-YLMETHYL)AMINO]METHYL)ANILINE
pro_mdlNumber: MFCD17440553
pro_acceptors: 3
pro_donors: 1
pro_smile: CCN(Cc1ccc(cc1N)Cl)Cc2ccco2
InChi: InChI=1S/C14H17ClN2O/c1-2-17(10-13-4-3-7-18-13)9-11-5-6-12(15)8-14(11)16/h3-8H,2,9-10,16H2,1H3
InChiKey: InChIKey=VOZVTDNXZACUKC-UHFFFAOYSA-N