N-(1,3-DIMETHYL-1H-PYRAZOL-5-YL)-2-(ETHYLAMINO)PYRIDINE-4-CARBOXAMIDE

pro_cas
pro_cdbregno
CCD03701698
pro_formula
C13 H17 N5 O
pro_molWeight
259.311

basic_info

Product_Name: N-(1,3-DIMETHYL-1H-PYRAZOL-5-YL)-2-(ETHYLAMINO)PYRIDINE-4-CARBOXAMIDE
EnglishSynonyms: N-(1,3-DIMETHYL-1H-PYRAZOL-5-YL)-2-(ETHYLAMINO)PYRIDINE-4-CARBOXAMIDE
pro_mdlNumber: MFCD17448439
pro_acceptors: 6
pro_donors: 2
pro_smile: CCNc1cc(ccn1)C(=O)Nc2cc(nn2C)C
InChi: InChI=1S/C13H17N5O/c1-4-14-11-8-10(5-6-15-11)13(19)16-12-7-9(2)17-18(12)3/h5-8H,4H2,1-3H3,(H,14,15)(H,16,19)
InChiKey: InChIKey=FEPQJFPGWFFLFJ-UHFFFAOYSA-N