1-[(5-CHLORO-1-METHYL-1H-IMIDAZOL-2-YL)METHYL]-6-OXOPIPERIDINE-3-CARBOXYLIC ACID

pro_cas
pro_cdbregno
CCD03706243
pro_formula
C11 H14 Cl N3 O3
pro_molWeight
271.703

basic_info

Product_Name: 1-[(5-CHLORO-1-METHYL-1H-IMIDAZOL-2-YL)METHYL]-6-OXOPIPERIDINE-3-CARBOXYLIC ACID
EnglishSynonyms: 1-[(5-CHLORO-1-METHYL-1H-IMIDAZOL-2-YL)METHYL]-6-OXOPIPERIDINE-3-CARBOXYLIC ACID
pro_mdlNumber: MFCD17453081
pro_acceptors: 6
pro_donors: 1
pro_smile: Cn1c(cnc1CN2CC(CCC2=O)C(=O)O)Cl
InChi: InChI=1S/C11H14ClN3O3/c1-14-8(12)4-13-9(14)6-15-5-7(11(17)18)2-3-10(15)16/h4,7H,2-3,5-6H2,1H3,(H,17,18)
InChiKey: InChIKey=ASSPNMDVAOHACQ-UHFFFAOYSA-N