N-METHYL-2-[(METHYLAMINO)METHYL]-N-[(5-METHYLFURAN-2-YL)METHYL]PYRIDIN-4-AMINE

pro_cas
pro_cdbregno
CCD03715407
pro_formula
C14 H19 N3 O
pro_molWeight
245.324

basic_info

Product_Name: N-METHYL-2-[(METHYLAMINO)METHYL]-N-[(5-METHYLFURAN-2-YL)METHYL]PYRIDIN-4-AMINE
EnglishSynonyms: N-METHYL-2-[(METHYLAMINO)METHYL]-N-[(5-METHYLFURAN-2-YL)METHYL]PYRIDIN-4-AMINE
pro_mdlNumber: MFCD17462511
pro_acceptors: 4
pro_donors: 1
pro_smile: Cc1ccc(o1)CN(C)c2ccnc(c2)CNC
InChi: InChI=1S/C14H19N3O/c1-11-4-5-14(18-11)10-17(3)13-6-7-16-12(8-13)9-15-2/h4-8,15H,9-10H2,1-3H3
InChiKey: InChIKey=QFJFLYBLJJVUOL-UHFFFAOYSA-N