5-CHLORO-N-METHYL-6-[(METHYLAMINO)METHYL]-N-(THIOPHEN-2-YLMETHYL)PYRIDIN-2-AMINE

pro_cas
pro_cdbregno
CCD03715410
pro_formula
C13 H16 Cl N3 S
pro_molWeight
281.809

basic_info

Product_Name: 5-CHLORO-N-METHYL-6-[(METHYLAMINO)METHYL]-N-(THIOPHEN-2-YLMETHYL)PYRIDIN-2-AMINE
EnglishSynonyms: 5-CHLORO-N-METHYL-6-[(METHYLAMINO)METHYL]-N-(THIOPHEN-2-YLMETHYL)PYRIDIN-2-AMINE
pro_mdlNumber: MFCD17462515
pro_acceptors: 3
pro_donors: 1
pro_smile: CNCc1c(ccc(n1)N(C)Cc2cccs2)Cl
InChi: InChI=1S/C13H16ClN3S/c1-15-8-12-11(14)5-6-13(16-12)17(2)9-10-4-3-7-18-10/h3-7,15H,8-9H2,1-2H3
InChiKey: InChIKey=TWQXYBMLRRICIB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.