BCH-RESEARCH BC465207

pro_cas
pro_cdbregno
CCD03719331
pro_formula
C14 H15 N3 O S
pro_molWeight
273.358

basic_info

Product_Name: BCH-RESEARCH BC465207
EnglishSynonyms: BCH-RESEARCH BC465207
pro_mdlNumber: MFCD17466548
pro_acceptors: 4
pro_donors: 3
pro_smile: CCc1ccc(s1)CNc2ccc3c(c2)[nH]c(=O)[nH]3
InChi: InChI=1S/C14H15N3OS/c1-2-10-4-5-11(19-10)8-15-9-3-6-12-13(7-9)17-14(18)16-12/h3-7,15H,2,8H2,1H3,(H2,16,17,18)
InChiKey: InChIKey=JOOZHOXQXYKRPH-UHFFFAOYSA-N