9-(2,5-DIMETHYLPHENYL)-N-METHYL-9-AZABICYCLO[3.3.1]NONAN-3-AMINE

pro_cas
pro_cdbregno
CCD03775881
pro_formula
C17 H26 N2
pro_molWeight
258.406

basic_info

Product_Name: 9-(2,5-DIMETHYLPHENYL)-N-METHYL-9-AZABICYCLO[3.3.1]NONAN-3-AMINE
EnglishSynonyms: 9-(2,5-DIMETHYLPHENYL)-N-METHYL-9-AZABICYCLO[3.3.1]NONAN-3-AMINE
pro_mdlNumber: MFCD17525213
pro_acceptors: 2
pro_donors: 1
pro_smile: Cc1ccc(c(c1)N2C3CCCC2CC(C3)NC)C
InChi: InChI=1S/C17H26N2/c1-12-7-8-13(2)17(9-12)19-15-5-4-6-16(19)11-14(10-15)18-3/h7-9,14-16,18H,4-6,10-11H2,1-3H3
InChiKey: InChIKey=SOYXRDNUNOUUOV-UHFFFAOYSA-N