ZERENEX ZXW004416

pro_cas
pro_cdbregno
CCD03788789
pro_formula
C15 H15 F2 N O2 S
pro_molWeight
311.35

basic_info

Product_Name: ZERENEX ZXW004416
EnglishSynonyms: ZERENEX ZXW004416
pro_mdlNumber: MFCD17543386
pro_acceptors: 3
pro_donors: 0
pro_smile: CC(c1ccc(cc1)F)N(C)S(=O)(=O)c2ccccc2F
InChi: InChI=1S/C15H15F2NO2S/c1-11(12-7-9-13(16)10-8-12)18(2)21(19,20)15-6-4-3-5-14(15)17/h3-11H,1-2H3
InChiKey: InChIKey=HAASWLUAGCXLSD-UHFFFAOYSA-N