C9 H6 Br Mg N


pro_mdlNumber: MFCD18253656
pro_acceptors: 1
pro_donors: 0
pro_smile: c1ccc2c(c1)ccc(n2)[Mg]Br
InChi: InChI=1S/C9H6N.BrH.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-6H;1H;/q;;+1/p-1

* If the product has intellectual property rights, a license granted is must or contact us.