CHEMMAKER BCB-53868

pro_cas
pro_cdbregno
CCD04407741
pro_formula
C16 H26 B N O2
pro_molWeight
275.197

basic_info

Product_Name: CHEMMAKER BCB-53868
EnglishSynonyms: CHEMMAKER BCB-53868
pro_mdlNumber: MFCD18731601
pro_acceptors: 3
pro_donors: 1
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2cc(ccc2CCNC)C
InChi: InChI=1S/C16H26BNO2/c1-12-7-8-13(9-10-18-6)14(11-12)17-19-15(2,3)16(4,5)20-17/h7-8,11,18H,9-10H2,1-6H3
InChiKey: InChIKey=HXABEKPFVFVLLL-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.