ETHYL 4-METHYL-3-OXOHEXANOATE

pro_cas
pro_cdbregno
CCD04521274
pro_formula
C9 H16 O3
pro_molWeight
172.222

basic_info

Product_Name: ETHYL 4-METHYL-3-OXOHEXANOATE
EnglishSynonyms: ETHYL 4-METHYL-3-OXOHEXANOATE
pro_mdlNumber: MFCD18872030
pro_acceptors: 3
pro_donors: 0
pro_smile: CCC(C)C(=O)CC(=O)OCC
InChi: InChI=1S/C9H16O3/c1-4-7(3)8(10)6-9(11)12-5-2/h7H,4-6H2,1-3H3
InChiKey: InChIKey=KHIHEUAINZCGRS-UHFFFAOYSA-N