TRIHEXYLARSINE

pro_cas
5852-60-8
pro_cdbregno
CCD04615148
pro_formula
C18 H39 As
pro_molWeight
330.428

basic_info

Product_Name: TRIHEXYLARSINE
CAS: 5852-60-8
EnglishSynonyms: TRIHEXYLARSINE
pro_mdlNumber: MFCD18974603
pro_acceptors: 0
pro_donors: 0
pro_smile: CCCCCC[As](CCCCCC)CCCCCC
InChi: InChI=1S/C18H39As/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3
InChiKey: InChIKey=WBZDESOJNATWDB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.