6-(ETHYLAMINO)-1,2-DIHYDROPYRIDIN-2-ONE

pro_cas
pro_cdbregno
CCD04823504
pro_formula
C7 H10 N2 O
pro_molWeight
138.169

basic_info

Product_Name: 6-(ETHYLAMINO)-1,2-DIHYDROPYRIDIN-2-ONE
EnglishSynonyms: 6-(ETHYLAMINO)-1,2-DIHYDROPYRIDIN-2-ONE
pro_mdlNumber: MFCD19223279
pro_acceptors: 3
pro_donors: 2
pro_smile: CCNc1cccc(=O)[nH]1
InChi: InChI=1S/C7H10N2O/c1-2-8-6-4-3-5-7(10)9-6/h3-5H,2H2,1H3,(H2,8,9,10)
InChiKey: InChIKey=LFTFHXNIRYNRQK-UHFFFAOYSA-N