8-[(6-AMINOHEXYL)OXY]QUINOLINE

pro_cas
pro_cdbregno
CCD05349633
pro_formula
C15 H20 N2 O
pro_molWeight
244.336

basic_info

Product_Name: 8-[(6-AMINOHEXYL)OXY]QUINOLINE
EnglishSynonyms: 8-[(6-AMINOHEXYL)OXY]QUINOLINE
pro_mdlNumber: MFCD20156507
pro_acceptors: 3
pro_donors: 1
pro_smile: c1cc2cccnc2c(c1)OCCCCCCN
InChi: InChI=1S/C15H20N2O/c16-10-3-1-2-4-12-18-14-9-5-7-13-8-6-11-17-15(13)14/h5-9,11H,1-4,10,12,16H2
InChiKey: InChIKey=YQPZNTLLYAQDNG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.