ETHYL 2-(BUT-3-EN-1-YLOXY)BUTANOATE

pro_cas
pro_cdbregno
CCD05537900
pro_formula
C10 H18 O3
pro_molWeight
186.249

basic_info

Product_Name: ETHYL 2-(BUT-3-EN-1-YLOXY)BUTANOATE
EnglishSynonyms: ETHYL 2-(BUT-3-EN-1-YLOXY)BUTANOATE
pro_mdlNumber: MFCD20383922
pro_acceptors: 3
pro_donors: 0
pro_smile: CCC(C(=O)OCC)OCCC=C
InChi: InChI=1S/C10H18O3/c1-4-7-8-13-9(5-2)10(11)12-6-3/h4,9H,1,5-8H2,2-3H3
InChiKey: InChIKey=KEPKTEDSBMMAJE-UHFFFAOYSA-N