2-ACETAMIDO-4-HYDROXYBENZOIC ACID

pro_cas
pro_cdbregno
CCD05634562
pro_formula
C9 H9 N O4
pro_molWeight
195.173

basic_info

Product_Name: 2-ACETAMIDO-4-HYDROXYBENZOIC ACID
EnglishSynonyms: 2-ACETAMIDO-4-HYDROXYBENZOIC ACID
pro_mdlNumber: MFCD20485810
pro_acceptors: 5
pro_donors: 3
pro_smile: CC(=O)Nc1cc(ccc1C(=O)O)O
InChi: InChI=1S/C9H9NO4/c1-5(11)10-8-4-6(12)2-3-7(8)9(13)14/h2-4,12H,1H3,(H,10,11)(H,13,14)
InChiKey: InChIKey=NFYYFDXVGWRTHV-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.