QUINOLIN-4-YLMAGNESIUM BROMIDE

pro_cas
pro_cdbregno
CCD07564881
pro_formula
C9 H6 Br Mg N
pro_molWeight
232.362

basic_info

Product_Name: QUINOLIN-4-YLMAGNESIUM BROMIDE
EnglishSynonyms: QUINOLIN-4-YLMAGNESIUM BROMIDE
pro_mdlNumber: MFCD22684754
pro_acceptors: 1
pro_donors: 0
pro_smile: c1ccc2c(c1)c(ccn2)[Mg]Br
InChi: InChI=1S/C9H6N.BrH.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-4,6-7H;1H;/q;;+1/p-1
InChiKey: InChIKey=RPRXHVQGHFNLKD-UHFFFAOYSA-M

* If the product has intellectual property rights, a license granted is must or contact us.