QUINOLIN-5-YLMAGNESIUM BROMIDE

pro_cas
pro_cdbregno
CCD07564883
pro_formula
C9 H6 Br Mg N
pro_molWeight
232.362

basic_info

Product_Name: QUINOLIN-5-YLMAGNESIUM BROMIDE
EnglishSynonyms: QUINOLIN-5-YLMAGNESIUM BROMIDE
pro_mdlNumber: MFCD22684756
pro_acceptors: 1
pro_donors: 0
pro_smile: c1cc2c(cccn2)c(c1)[Mg]Br
InChi: InChI=1S/C9H6N.BrH.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-3,5-7H;1H;/q;;+1/p-1
InChiKey: InChIKey=KEHOAMFBBWLHRU-UHFFFAOYSA-M

* If the product has intellectual property rights, a license granted is must or contact us.