TERT-BUTYL((2-[5-(5-ETHYLFURAN-2-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE

pro_cas
pro_cdbregno
CCD07715586
pro_formula
C14 H21 N3 O2
pro_molWeight
263.339

basic_info

Product_Name: TERT-BUTYL((2-[5-(5-ETHYLFURAN-2-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE
EnglishSynonyms: TERT-BUTYL((2-[5-(5-ETHYLFURAN-2-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE
pro_mdlNumber: MFCD22835608
pro_acceptors: 5
pro_donors: 1
pro_smile: CCc1ccc(o1)c2nnc(o2)CCNC(C)(C)C
InChi: InChI=1S/C14H21N3O2/c1-5-10-6-7-11(18-10)13-17-16-12(19-13)8-9-15-14(2,3)4/h6-7,15H,5,8-9H2,1-4H3
InChiKey: InChIKey=BLCBCVJQAVWFJO-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.