4-((2-CHLORO-1H-BENZO[D]IMIDAZOL-1-YL)METHYL)BENZONITRILE

pro_cas
pro_cdbregno
CCD07997562
pro_formula
C15 H10 Cl N3
pro_molWeight
267.718

basic_info

Product_Name: 4-((2-CHLORO-1H-BENZO[D]IMIDAZOL-1-YL)METHYL)BENZONITRILE
EnglishSynonyms: 4-((2-CHLORO-1H-BENZO[D]IMIDAZOL-1-YL)METHYL)BENZONITRILE
pro_mdlNumber: MFCD23132850
pro_acceptors: 3
pro_donors: 0
pro_smile: c1ccc2c(c1)nc(n2Cc3ccc(cc3)C#N)Cl
InChi: InChI=1S/C15H10ClN3/c16-15-18-13-3-1-2-4-14(13)19(15)10-12-7-5-11(9-17)6-8-12/h1-8H,10H2
InChiKey: InChIKey=FZUPKGWETJGLQY-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.