1,1'-(1-ETHYLPROPYLIDENE)BIS-1H-PYRAZOLE

pro_cas
pro_cdbregno
CCD08028257
pro_formula
C11 H16 N4
pro_molWeight
204.275

basic_info

Product_Name: 1,1'-(1-ETHYLPROPYLIDENE)BIS-1H-PYRAZOLE
EnglishSynonyms: 1,1'-(1-ETHYLPROPYLIDENE)BIS-1H-PYRAZOLE
pro_mdlNumber: MFCD00192165
pro_acceptors: 4
pro_donors: 0
pro_smile: CCC(CCn1cccn1)n2cccn2
InChi: InChI=1S/C11H16N4/c1-2-11(15-9-4-7-13-15)5-10-14-8-3-6-12-14/h3-4,6-9,11H,2,5,10H2,1H3
InChiKey: InChIKey=UWKDLCXPEYIEBM-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.