BENZYL PIPERIDINE-1-CARBOXYLATE

pro_cas
pro_cdbregno
CCD08240151
pro_formula
C13 H17 N O2
pro_molWeight
219.282

basic_info

Product_Name: BENZYL PIPERIDINE-1-CARBOXYLATE
EnglishSynonyms: BENZYL PIPERIDINE-1-CARBOXYLATE
pro_mdlNumber: MFCD11110947
pro_acceptors: 3
pro_donors: 0
pro_smile: c1ccc(cc1)COC(=O)N2CCCCC2
InChi: InChI=1S/C13H17NO2/c15-13(14-9-5-2-6-10-14)16-11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2
InChiKey: InChIKey=TUWZZXGAUMSUOB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.