N-Fmoc-3-[[(4-methoxyphenyl)methoxy]methyl]-L-histidine

pro_cas
1327338-56-6
pro_cdbregno
CCD08286719
pro_formula
C30H29N3O6
pro_molWeight
527.5678

basic_info

Product_Name: N-Fmoc-3-[[(4-methoxyphenyl)methoxy]methyl]-L-histidine
CAS: 1327338-56-6
EnglishSynonyms: N-FMOC-3-[[(4-METHOXYPHENYL)METHOXY]METHYL]-L-HISTIDINE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N[C@@H](CC1=CN=CN1COCC1=CC=C(C=C1)OC)C(=O)O
InChi: InChI=1S/C30H29N3O6/c1-37-22-12-10-20(11-13-22)16-38-19-33-18-31-15-21(33)14-28(29(34)35)32-30(36)39-17-27-25-8-4-2-6-23(25)24-7-3-5-9-26(24)27/h2-13,15,18,27-28H,14,16-17,19H2,1H3,(H,32,36)(H,34,35)/t28-/m0/s1
InChiKey: InChIKey=GNRWPIOMPVOAOH-NDEPHWFRSA-N

property

secure_info