2-Piperidinecarboxylic acid, 1-(cyanomethyl)-, ethyl ester

pro_cas
15932-69-1
pro_cdbregno
CCD08286944
pro_formula
C10H16N2O2
pro_molWeight
196.2462

basic_info

Product_Name: 2-Piperidinecarboxylic acid, 1-(cyanomethyl)-, ethyl ester
CAS: 15932-69-1
EnglishSynonyms: 2-PIPERIDINECARBOXYLIC ACID, 1-(CYANOMETHYL)-, ETHYL ESTER
pro_acceptors: 0
pro_donors: 0
pro_smile: C(#N)CN1C(CCCC1)C(=O)OCC
InChi: InChI=1S/C10H16N2O2/c1-2-14-10(13)9-5-3-4-7-12(9)8-6-11/h9H,2-5,7-8H2,1H3
InChiKey: InChIKey=KONAHYKUFSIOCM-UHFFFAOYSA-N

property

secure_info