1,1'-([1,1':4',1''-Terphenyl]-4,4''-diyl)diethanone

pro_cas
4191-07-5
pro_cdbregno
CCD08288170
pro_formula
C22H18O2
pro_molWeight
314.3771

basic_info

Product_Name: 1,1'-([1,1':4',1''-Terphenyl]-4,4''-diyl)diethanone
CAS: 4191-07-5
EnglishSynonyms: 1,1'-([1,1':4',1''-TERPHENYL]-4,4''-DIYL)DIETHANONE
pro_acceptors: 0
pro_donors: 0
pro_smile: C1(=CC=C(C=C1)C(C)=O)C1=CC=C(C=C1)C1=CC=C(C=C1)C(C)=O
InChi: InChI=1S/C22H18O2/c1-15(23)17-3-7-19(8-4-17)21-11-13-22(14-12-21)20-9-5-18(6-10-20)16(2)24/h3-14H,1-2H3
InChiKey: InChIKey=LSRWKYYPPBDFRR-UHFFFAOYSA-N

property

secure_info