Benzamide, N-(cyanomethyl)-3,4-difluoro-

pro_cas
211614-67-4
pro_cdbregno
CCD08288794
pro_formula
C9H6F2N2O
pro_molWeight
196.1535

basic_info

Product_Name: Benzamide, N-(cyanomethyl)-3,4-difluoro-
CAS: 211614-67-4
EnglishSynonyms: BENZAMIDE, N-(CYANOMETHYL)-3,4-DIFLUORO-
pro_acceptors: 0
pro_donors: 0
pro_smile: C(#N)CNC(C1=CC(=C(C=C1)F)F)=O
InChi: InChI=1S/C9H6F2N2O/c10-7-2-1-6(5-8(7)11)9(14)13-4-3-12/h1-2,5H,4H2,(H,13,14)
InChiKey: InChIKey=OECASCREJKKMJL-UHFFFAOYSA-N

property

secure_info