Propanamide, 3-chloro-N,N-bis(1-methylethyl)-

pro_cas
28225-39-0
pro_cdbregno
CCD08288902
pro_formula
C9H18ClNO
pro_molWeight
191.698

basic_info

Product_Name: Propanamide, 3-chloro-N,N-bis(1-methylethyl)-
CAS: 28225-39-0
EnglishSynonyms: PROPANAMIDE, 3-CHLORO-N,N-BIS(1-METHYLETHYL)-
pro_acceptors: 0
pro_donors: 0
pro_smile: ClCCC(=O)N(C(C)C)C(C)C
InChi: InChI=1S/C9H18ClNO/c1-7(2)11(8(3)4)9(12)5-6-10/h7-8H,5-6H2,1-4H3
InChiKey: InChIKey=FBTYPEFAEZROTC-UHFFFAOYSA-N

property

secure_info