4-bromo-2-fluoro-1-((2,2,2-trifluoroethoxy)methyl)benzene

pro_cas
1247562-38-4
pro_cdbregno
CCD08290030
pro_formula
C9H7BrF4O
pro_molWeight
287.049

basic_info

Product_Name: 4-bromo-2-fluoro-1-((2,2,2-trifluoroethoxy)methyl)benzene
CAS: 1247562-38-4
EnglishSynonyms: 4-BROMO-2-FLUORO-1-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZENE
pro_acceptors: 0
pro_donors: 0
pro_smile: BrC1=CC(=C(C=C1)COCC(F)(F)F)F
InChi: InChI=1S/C9H7BrF4O/c10-7-2-1-6(8(11)3-7)4-15-5-9(12,13)14/h1-3H,4-5H2
InChiKey: InChIKey=DKPVHUYVIXFNCT-UHFFFAOYSA-N

property

secure_info