2-(((1-Methylpiperidin-2-yl)methyl)amino)acetic acid

pro_cas
1247668-29-6
pro_cdbregno
CCD08290997
pro_formula
C9H18N2O2
pro_molWeight
186.2514

basic_info

Product_Name: 2-(((1-Methylpiperidin-2-yl)methyl)amino)acetic acid
CAS: 1247668-29-6
EnglishSynonyms: 2-(((1-METHYLPIPERIDIN-2-YL)METHYL)AMINO)ACETIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: CN1C(CCCC1)CNCC(=O)O
InChi: InChI=1S/C9H18N2O2/c1-11-5-3-2-4-8(11)6-10-7-9(12)13/h8,10H,2-7H2,1H3,(H,12,13)
InChiKey: InChIKey=VEKMGTNBUSSQAD-UHFFFAOYSA-N

property

secure_info