3-(Methylamino)cyclobutanol

pro_cas
1354952-94-5
pro_cdbregno
CCD08291799
pro_formula
C5H11NO
pro_molWeight
101.1469

basic_info

Product_Name: 3-(Methylamino)cyclobutanol
CAS: 1354952-94-5
EnglishSynonyms: 3-(METHYLAMINO)CYCLOBUTANOL
pro_acceptors: 0
pro_donors: 0
pro_smile: CNC1CC(C1)O
InChi: InChI=1S/C5H11NO/c1-6-4-2-5(7)3-4/h4-7H,2-3H2,1H3
InChiKey: InChIKey=DRLQGNZKHKBJFA-UHFFFAOYSA-N

property

secure_info