2-[Methyl-(4-nitrophenyl)amino]acetic acid

pro_cas
98953-48-1
pro_cdbregno
CCD08295941
pro_formula
C9H10N2O4
pro_molWeight
210.1867

basic_info

Product_Name: 2-[Methyl-(4-nitrophenyl)amino]acetic acid
CAS: 98953-48-1
EnglishSynonyms: 2-[METHYL-(4-NITROPHENYL)AMINO]ACETIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: CN(CC(=O)O)C1=CC=C(C=C1)[N+](=O)[O-]
InChi: InChI=1S/C9H10N2O4/c1-10(6-9(12)13)7-2-4-8(5-3-7)11(14)15/h2-5H,6H2,1H3,(H,12,13)
InChiKey: InChIKey=MTYVHSVHCBZXSV-UHFFFAOYSA-N

property

secure_info