2-[2-(6-BroMohexyloxy)ethoxyMethyl]-1,3-dichlorobenzene

pro_cas
503070-57-3
pro_cdbregno
CCD08297911
pro_formula
C15H21BrCl2O2
pro_molWeight
384.136

basic_info

Product_Name: 2-[2-(6-BroMohexyloxy)ethoxyMethyl]-1,3-dichlorobenzene
CAS: 503070-57-3
EnglishSynonyms: 2-[2-(6-BROMOHEXYLOXY)ETHOXYMETHYL]-1,3-DICHLOROBENZENE
pro_acceptors: 0
pro_donors: 0
pro_smile: BrCCCCCCOCCOCC1=C(C=CC=C1Cl)Cl
InChi: InChI=1S/C15H21BrCl2O2/c16-8-3-1-2-4-9-19-10-11-20-12-13-14(17)6-5-7-15(13)18/h5-7H,1-4,8-12H2
InChiKey: InChIKey=AKLUHFHHUBIDQA-UHFFFAOYSA-N

property

secure_info